About ethyl 9H-pyrido[3,4-b]indole-1-carboxylate
ethyl 9H-pyrido[3,4-b]indole-1-carboxylate (PubChem CID 11701473) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl 9H-pyrido[3,4-b]indole-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 9H-pyrido[3,4-b]indole-1-carboxylate |
| PubChem CID | 11701473 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | ethyl 9H-pyrido[3,4-b]indole-1-carboxylate |
| SMILES | CCOC(=O)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C14H12N2O2/c1-2-18-14(17)13-12-10(7-8-15-13)9-5-3-4-6-11(9)16-12/h3-8,16H,2H2,1H3 |
| InChIKey | CFXOOHNXLDSCHT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 9H-pyrido[3,4-b]indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9H-pyrido[3,4-b]indole-1-carboxylate?
The IUPAC name of ethyl 9H-pyrido[3,4-b]indole-1-carboxylate (CID 11701473) is ethyl 9H-pyrido[3,4-b]indole-1-carboxylate.
What is the SMILES notation for ethyl 9H-pyrido[3,4-b]indole-1-carboxylate?
The canonical SMILES for ethyl 9H-pyrido[3,4-b]indole-1-carboxylate is CCOC(=O)c1nccc2c1[nH]c1ccccc12.
What is the InChIKey of ethyl 9H-pyrido[3,4-b]indole-1-carboxylate?
The InChIKey is CFXOOHNXLDSCHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c1-2-18-14(17)13-12-10(7-8-15-13)9-5-3-4-6-11(9)16-12/h3-8,16H,2H2,1H3.
What are the key properties of ethyl 9H-pyrido[3,4-b]indole-1-carboxylate?
ethyl 9H-pyrido[3,4-b]indole-1-carboxylate has a molecular weight of 240.26 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9H-pyrido[3,4-b]indole-1-carboxylate is sourced from PubChem (CID 11701473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).