About 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one
7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one (PubChem CID 117014946) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one.
Molecular Properties
| Compound Name | 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one |
| PubChem CID | 117014946 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one |
| SMILES | Cc1ccc(CN2CC(C)(C)CNCCC2=O)cc1 |
| InChI | InChI=1S/C16H24N2O/c1-13-4-6-14(7-5-13)10-18-12-16(2,3)11-17-9-8-15(18)19/h4-7,17H,8-12H2,1-3H3 |
| InChIKey | NCTDTSZVSKVJHY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one?
The IUPAC name of 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one (CID 117014946) is 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one.
What is the SMILES notation for 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one?
The canonical SMILES for 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one is Cc1ccc(CN2CC(C)(C)CNCCC2=O)cc1.
What is the InChIKey of 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one?
The InChIKey is NCTDTSZVSKVJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-13-4-6-14(7-5-13)10-18-12-16(2,3)11-17-9-8-15(18)19/h4-7,17H,8-12H2,1-3H3.
What are the key properties of 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one?
7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one has a molecular weight of 260.38 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-1-[(4-methylphenyl)methyl]-1,5-diazocan-2-one is sourced from PubChem (CID 117014946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).