C14H19FN2O — CID 117014978
1-(3-fluorophenyl)-7,7-dimethyl-1,5-diazocan-2-one (PubChem CID 117014978) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-7,7-dimethyl-1,5-diazocan-2-one.
| Compound Name | 1-(3-fluorophenyl)-7,7-dimethyl-1,5-diazocan-2-one |
|---|---|
| PubChem CID | 117014978 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-(3-fluorophenyl)-7,7-dimethyl-1,5-diazocan-2-one |
| SMILES | CC1(C)CNCCC(=O)N(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H19FN2O/c1-14(2)9-16-7-6-13(18)17(10-14)12-5-3-4-11(15)8-12/h3-5,8,16H,6-7,9-10H2,1-2H3 |
| InChIKey | KLFGWCKLGCNMSL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |