C11H17N3O2S — CID 117015658
1,1-dioxo-2-propan-2-yl-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-8-amine (PubChem CID 117015658) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1,1-dioxo-2-propan-2-yl-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-8-amine.
| Compound Name | 1,1-dioxo-2-propan-2-yl-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-8-amine |
|---|---|
| PubChem CID | 117015658 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1,1-dioxo-2-propan-2-yl-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-8-amine |
| SMILES | CC(C)N1CCNc2ccc(N)cc2S1(=O)=O |
| InChI | InChI=1S/C11H17N3O2S/c1-8(2)14-6-5-13-10-4-3-9(12)7-11(10)17(14,15)16/h3-4,7-8,13H,5-6,12H2,1-2H3 |
| InChIKey | HSQBADOLINFNNH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|