C17H18N2O — CID 117015886
6-benzyl-1,2,3,4-tetrahydro-1,6-benzodiazocin-5-one (PubChem CID 117015886) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 6-benzyl-1,2,3,4-tetrahydro-1,6-benzodiazocin-5-one.
| Compound Name | 6-benzyl-1,2,3,4-tetrahydro-1,6-benzodiazocin-5-one |
|---|---|
| PubChem CID | 117015886 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 6-benzyl-1,2,3,4-tetrahydro-1,6-benzodiazocin-5-one |
| SMILES | O=C1CCCNc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2O/c20-17-11-6-12-18-15-9-4-5-10-16(15)19(17)13-14-7-2-1-3-8-14/h1-5,7-10,18H,6,11-13H2 |
| InChIKey | HJHWLWRSEXTRAH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |