C16H16N2O — CID 117016035
5-phenyl-1,2,3,4-tetrahydro-2,5-benzodiazocin-6-one (PubChem CID 117016035) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 5-phenyl-1,2,3,4-tetrahydro-2,5-benzodiazocin-6-one.
| Compound Name | 5-phenyl-1,2,3,4-tetrahydro-2,5-benzodiazocin-6-one |
|---|---|
| PubChem CID | 117016035 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 5-phenyl-1,2,3,4-tetrahydro-2,5-benzodiazocin-6-one |
| SMILES | O=C1c2ccccc2CNCCN1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c19-16-15-9-5-4-6-13(15)12-17-10-11-18(16)14-7-2-1-3-8-14/h1-9,17H,10-12H2 |
| InChIKey | LHLUPZUVQPTXKZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |