About ditert-butyl chloromethyl phosphate
ditert-butyl chloromethyl phosphate (PubChem CID 11701630) has the molecular formula C9H20ClO4P
and a molecular weight of 258.68 g/mol. Its IUPAC name is ditert-butyl chloromethyl phosphate.
Molecular Properties
| Compound Name | ditert-butyl chloromethyl phosphate |
| PubChem CID | 11701630 |
| Molecular Formula | C9H20ClO4P |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | ditert-butyl chloromethyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCCl)OC(C)(C)C |
| InChI | InChI=1S/C9H20ClO4P/c1-8(2,3)13-15(11,12-7-10)14-9(4,5)6/h7H2,1-6H3 |
| InChIKey | LNJAJHJFSKUCIR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl chloromethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl chloromethyl phosphate?
The IUPAC name of ditert-butyl chloromethyl phosphate (CID 11701630) is ditert-butyl chloromethyl phosphate.
What is the SMILES notation for ditert-butyl chloromethyl phosphate?
The canonical SMILES for ditert-butyl chloromethyl phosphate is CC(C)(C)OP(=O)(OCCl)OC(C)(C)C.
What is the InChIKey of ditert-butyl chloromethyl phosphate?
The InChIKey is LNJAJHJFSKUCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20ClO4P/c1-8(2,3)13-15(11,12-7-10)14-9(4,5)6/h7H2,1-6H3.
What are the key properties of ditert-butyl chloromethyl phosphate?
ditert-butyl chloromethyl phosphate has a molecular weight of 258.68 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl chloromethyl phosphate is sourced from PubChem (CID 11701630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).