C17H28N2 — CID 117016490
1-(2-ethyl-6-methylphenyl)-3,3-dimethyl-1,4-diazocane (PubChem CID 117016490) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-(2-ethyl-6-methylphenyl)-3,3-dimethyl-1,4-diazocane.
| Compound Name | 1-(2-ethyl-6-methylphenyl)-3,3-dimethyl-1,4-diazocane |
|---|---|
| PubChem CID | 117016490 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-(2-ethyl-6-methylphenyl)-3,3-dimethyl-1,4-diazocane |
| SMILES | CCc1cccc(C)c1N1CCCCNC(C)(C)C1 |
| InChI | InChI=1S/C17H28N2/c1-5-15-10-8-9-14(2)16(15)19-12-7-6-11-18-17(3,4)13-19/h8-10,18H,5-7,11-13H2,1-4H3 |
| InChIKey | HUECBIXBAJUCJU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |