C10H22N2O2S — CID 117016531
2-butan-2-yl-4-methyl-1,2,5-thiadiazocane 1,1-dioxide (PubChem CID 117016531) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is 2-butan-2-yl-4-methyl-1,2,5-thiadiazocane 1,1-dioxide.
| Compound Name | 2-butan-2-yl-4-methyl-1,2,5-thiadiazocane 1,1-dioxide |
|---|---|
| PubChem CID | 117016531 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-butan-2-yl-4-methyl-1,2,5-thiadiazocane 1,1-dioxide |
| SMILES | CCC(C)N1CC(C)NCCCS1(=O)=O |
| InChI | InChI=1S/C10H22N2O2S/c1-4-10(3)12-8-9(2)11-6-5-7-15(12,13)14/h9-11H,4-8H2,1-3H3 |
| InChIKey | MAHQBMXEKBWLIX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |