About 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol
1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol (PubChem CID 117016811) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol |
| PubChem CID | 117016811 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol |
| SMILES | CC1(C)C(O)CCN1C1CCCCCC1 |
| InChI | InChI=1S/C13H25NO/c1-13(2)12(15)9-10-14(13)11-7-5-3-4-6-8-11/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | XTVKOUVYQDPNES-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol?
The IUPAC name of 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol (CID 117016811) is 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol.
What is the SMILES notation for 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol?
The canonical SMILES for 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol is CC1(C)C(O)CCN1C1CCCCCC1.
What is the InChIKey of 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol?
The InChIKey is XTVKOUVYQDPNES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-13(2)12(15)9-10-14(13)11-7-5-3-4-6-8-11/h11-12,15H,3-10H2,1-2H3.
What are the key properties of 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol?
1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol has a molecular weight of 211.35 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptyl-2,2-dimethylpyrrolidin-3-ol is sourced from PubChem (CID 117016811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).