C15H18N2O2 — CID 117017237
methyl 3-(3-cyano-2,2-dimethylpyrrolidin-1-yl)benzoate (PubChem CID 117017237) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is methyl 3-(3-cyano-2,2-dimethylpyrrolidin-1-yl)benzoate.
| Compound Name | methyl 3-(3-cyano-2,2-dimethylpyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 117017237 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | methyl 3-(3-cyano-2,2-dimethylpyrrolidin-1-yl)benzoate |
| SMILES | COC(=O)c1cccc(N2CCC(C#N)C2(C)C)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-15(2)12(10-16)7-8-17(15)13-6-4-5-11(9-13)14(18)19-3/h4-6,9,12H,7-8H2,1-3H3 |
| InChIKey | DLIUWSBYNKWCJD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |