About 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine
5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine (PubChem CID 11701727) has the molecular formula C12H10Cl2N2O
and a molecular weight of 269.13 g/mol. Its IUPAC name is 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine |
| PubChem CID | 11701727 |
| Molecular Formula | C12H10Cl2N2O |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine |
| SMILES | Cc1noc(/C=C/c2c(Cl)cccc2Cl)c1N |
| InChI | InChI=1S/C12H10Cl2N2O/c1-7-12(15)11(17-16-7)6-5-8-9(13)3-2-4-10(8)14/h2-6H,15H2,1H3/b6-5+ |
| InChIKey | PEIRNLFIADOSGA-AATRIKPKSA-N |
| XLogP | 4.04 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine?
The IUPAC name of 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine (CID 11701727) is 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine.
What is the SMILES notation for 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine?
The canonical SMILES for 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine is Cc1noc(/C=C/c2c(Cl)cccc2Cl)c1N.
What is the InChIKey of 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine?
The InChIKey is PEIRNLFIADOSGA-AATRIKPKSA-N. The full InChI is InChI=1S/C12H10Cl2N2O/c1-7-12(15)11(17-16-7)6-5-8-9(13)3-2-4-10(8)14/h2-6H,15H2,1H3/b6-5+.
What are the key properties of 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine?
5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine has a molecular weight of 269.13 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-amine is sourced from PubChem (CID 11701727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).