C13H25N3O3 — CID 11701760
tert-butyl 4-[[(2-aminoacetyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 11701760) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl 4-[[(2-aminoacetyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2-aminoacetyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11701760 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | tert-butyl 4-[[(2-aminoacetyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)CN)CC1 |
| InChI | InChI=1S/C13H25N3O3/c1-13(2,3)19-12(18)16-6-4-10(5-7-16)9-15-11(17)8-14/h10H,4-9,14H2,1-3H3,(H,15,17) |
| InChIKey | SPUCYXUVHHDCEC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |