5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid

C12H23NO2 — CID 117018394

IUPAC5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid
SMILESCCCCCN1CC(C(=O)O)CC1(C)C
InChIInChI=1S/C12H23NO2/c1-4-5-6-7-13-9-10(11(14)15)8-12(13,2)3/h10H,4-9H2,1-3H3,(H,14,15)
InChIKeyGVLAUKAUSMBMOQ-UHFFFAOYSA-N
MW213.32 g/mol
LogP2.36
Rot. Bonds5

About 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid

5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid (PubChem CID 117018394) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid
PubChem CID117018394
Molecular FormulaC12H23NO2
Molecular Weight213.32 g/mol
Exact Mass213.17
IUPAC Name5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid
SMILESCCCCCN1CC(C(=O)O)CC1(C)C
InChIInChI=1S/C12H23NO2/c1-4-5-6-7-13-9-10(11(14)15)8-12(13,2)3/h10H,4-9H2,1-3H3,(H,14,15)
InChIKeyGVLAUKAUSMBMOQ-UHFFFAOYSA-N
XLogP2.36
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.32
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid?
The IUPAC name of 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid (CID 117018394) is 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid is CCCCCN1CC(C(=O)O)CC1(C)C.
What is the InChIKey of 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid?
The InChIKey is GVLAUKAUSMBMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-4-5-6-7-13-9-10(11(14)15)8-12(13,2)3/h10H,4-9H2,1-3H3,(H,14,15).
What are the key properties of 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid?
5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid has a molecular weight of 213.32 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1-pentylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 117018394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).