C9H16N2 — CID 117019334
1,2,2-trimethylpiperidine-3-carbonitrile (PubChem CID 117019334) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,2,2-trimethylpiperidine-3-carbonitrile.
| Compound Name | 1,2,2-trimethylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 117019334 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,2,2-trimethylpiperidine-3-carbonitrile |
| SMILES | CN1CCCC(C#N)C1(C)C |
| InChI | InChI=1S/C9H16N2/c1-9(2)8(7-10)5-4-6-11(9)3/h8H,4-6H2,1-3H3 |
| InChIKey | VWFQIEATHLXZRP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |