C13H19NO4S — CID 11701937
(4S,5S)-2,2-dimethyl-4-(4-methylsulfonylphenyl)-1,3-dioxan-5-amine (PubChem CID 11701937) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4-(4-methylsulfonylphenyl)-1,3-dioxan-5-amine.
| Compound Name | (4S,5S)-2,2-dimethyl-4-(4-methylsulfonylphenyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 11701937 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4-(4-methylsulfonylphenyl)-1,3-dioxan-5-amine |
| SMILES | CC1(C)OC[C@H](N)C(c2ccc(S(C)(=O)=O)cc2)O1 |
| InChI | InChI=1S/C13H19NO4S/c1-13(2)17-8-11(14)12(18-13)9-4-6-10(7-5-9)19(3,15)16/h4-7,11-12H,8,14H2,1-3H3/t11-,12?/m0/s1 |
| InChIKey | GKXCXGRJEOYBKH-PXYINDEMSA-N |
| XLogP | 1.24 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |