About N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine
N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine (PubChem CID 117019831) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine.
Analyze N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine?
The IUPAC name of N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine (CID 117019831) is N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine.
What is the SMILES notation for N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine?
The canonical SMILES for N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine is CNCC1CCCN(C)C1(C)C.
What is the InChIKey of N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine?
The InChIKey is LKFGSTUKXRFBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-10(2)9(8-11-3)6-5-7-12(10)4/h9,11H,5-8H2,1-4H3.
What are the key properties of N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine?
N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine has a molecular weight of 170.30 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(1,2,2-trimethylpiperidin-3-yl)methanamine is sourced from PubChem (CID 117019831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).