C15H31N3 — CID 117019904
1-(1-tert-butyl-2,2-dimethylpiperidin-3-yl)piperazine (PubChem CID 117019904) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 1-(1-tert-butyl-2,2-dimethylpiperidin-3-yl)piperazine.
| Compound Name | 1-(1-tert-butyl-2,2-dimethylpiperidin-3-yl)piperazine |
|---|---|
| PubChem CID | 117019904 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 1-(1-tert-butyl-2,2-dimethylpiperidin-3-yl)piperazine |
| SMILES | CC(C)(C)N1CCCC(N2CCNCC2)C1(C)C |
| InChI | InChI=1S/C15H31N3/c1-14(2,3)18-10-6-7-13(15(18,4)5)17-11-8-16-9-12-17/h13,16H,6-12H2,1-5H3 |
| InChIKey | FJVBGMJOSRMATH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |