C16H26N2 — CID 117020196
1-(3,4-dimethylphenyl)-N,2,2-trimethylpiperidin-4-amine (PubChem CID 117020196) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N,2,2-trimethylpiperidin-4-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-N,2,2-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 117020196 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N,2,2-trimethylpiperidin-4-amine |
| SMILES | CNC1CCN(c2ccc(C)c(C)c2)C(C)(C)C1 |
| InChI | InChI=1S/C16H26N2/c1-12-6-7-15(10-13(12)2)18-9-8-14(17-5)11-16(18,3)4/h6-7,10,14,17H,8-9,11H2,1-5H3 |
| InChIKey | GQFDNXPYMOEFJL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |