C16H19N3 — CID 117021420
2-[5-(cyanomethyl)-2,2-dimethylpiperidin-1-yl]benzonitrile (PubChem CID 117021420) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[5-(cyanomethyl)-2,2-dimethylpiperidin-1-yl]benzonitrile.
| Compound Name | 2-[5-(cyanomethyl)-2,2-dimethylpiperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 117021420 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-[5-(cyanomethyl)-2,2-dimethylpiperidin-1-yl]benzonitrile |
| SMILES | CC1(C)CCC(CC#N)CN1c1ccccc1C#N |
| InChI | InChI=1S/C16H19N3/c1-16(2)9-7-13(8-10-17)12-19(16)15-6-4-3-5-14(15)11-18/h3-6,13H,7-9,12H2,1-2H3 |
| InChIKey | JUOZUAPCDQBGPI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |