C25H24N4O2S — CID 1170222
2-[(4,5-dibenzyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide (PubChem CID 1170222) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[(4,5-dibenzyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4,5-dibenzyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1170222 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[(4,5-dibenzyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CSc1nnc(Cc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H24N4O2S/c1-31-22-15-9-8-14-21(22)26-24(30)18-32-25-28-27-23(16-19-10-4-2-5-11-19)29(25)17-20-12-6-3-7-13-20/h2-15H,16-18H2,1H3,(H,26,30) |
| InChIKey | ASVLUMYCVYEOFR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |