C16H18O4S — CID 11702253
2,2-dimethyl-5-[(4-propan-2-ylphenyl)sulfanylmethylidene]-1,3-dioxane-4,6-dione (PubChem CID 11702253) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(4-propan-2-ylphenyl)sulfanylmethylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(4-propan-2-ylphenyl)sulfanylmethylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11702253 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2,2-dimethyl-5-[(4-propan-2-ylphenyl)sulfanylmethylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC(C)c1ccc(SC=C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C16H18O4S/c1-10(2)11-5-7-12(8-6-11)21-9-13-14(17)19-16(3,4)20-15(13)18/h5-10H,1-4H3 |
| InChIKey | DLLIETNKJLBTCA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|