C11H13BrN2O — CID 117022547
4-amino-1-(2-bromophenyl)-5-methylpyrrolidin-2-one (PubChem CID 117022547) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is 4-amino-1-(2-bromophenyl)-5-methylpyrrolidin-2-one.
| Compound Name | 4-amino-1-(2-bromophenyl)-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 117022547 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-amino-1-(2-bromophenyl)-5-methylpyrrolidin-2-one |
| SMILES | CC1C(N)CC(=O)N1c1ccccc1Br |
| InChI | InChI=1S/C11H13BrN2O/c1-7-9(13)6-11(15)14(7)10-5-3-2-4-8(10)12/h2-5,7,9H,6,13H2,1H3 |
| InChIKey | VLJRYKXNJWMHNR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |