C12H21NO3 — CID 117022864
2,2-dimethyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid (PubChem CID 117022864) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2,2-dimethyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid.
| Compound Name | 2,2-dimethyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117022864 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2,2-dimethyl-5-oxo-1-pentylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCN1C(=O)CC(C(=O)O)C1(C)C |
| InChI | InChI=1S/C12H21NO3/c1-4-5-6-7-13-10(14)8-9(11(15)16)12(13,2)3/h9H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | SCYDLZRVHGYIDQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|