About (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one
(3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one (PubChem CID 11702344) has the molecular formula C8H8Br2O3
and a molecular weight of 311.96 g/mol. Its IUPAC name is (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one.
Molecular Properties
| Compound Name | (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one |
| PubChem CID | 11702344 |
| Molecular Formula | C8H8Br2O3 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.88 |
| IUPAC Name | (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one |
| SMILES | O=C1OCC/C1=C1\OCCC1(Br)Br |
| InChI | InChI=1S/C8H8Br2O3/c9-8(10)2-4-12-6(8)5-1-3-13-7(5)11/h1-4H2/b6-5+ |
| InChIKey | MNKZHXHSOQHSBQ-AATRIKPKSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one?
The IUPAC name of (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one (CID 11702344) is (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one.
What is the SMILES notation for (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one?
The canonical SMILES for (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one is O=C1OCC/C1=C1\OCCC1(Br)Br.
What is the InChIKey of (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one?
The InChIKey is MNKZHXHSOQHSBQ-AATRIKPKSA-N. The full InChI is InChI=1S/C8H8Br2O3/c9-8(10)2-4-12-6(8)5-1-3-13-7(5)11/h1-4H2/b6-5+.
What are the key properties of (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one?
(3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one has a molecular weight of 311.96 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(3,3-dibromooxolan-2-ylidene)oxolan-2-one is sourced from PubChem (CID 11702344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).