About 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one
4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one (PubChem CID 117023493) has the molecular formula C13H17ClN2O
and a molecular weight of 252.74 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one |
| PubChem CID | 117023493 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1(C)CNCCC(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O/c1-13(2)9-15-7-6-12(17)16(13)11-5-3-4-10(14)8-11/h3-5,8,15H,6-7,9H2,1-2H3 |
| InChIKey | WNSOPBKKBSOAAZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one?
The IUPAC name of 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one (CID 117023493) is 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one.
What is the SMILES notation for 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one?
The canonical SMILES for 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one is CC1(C)CNCCC(=O)N1c1cccc(Cl)c1.
What is the InChIKey of 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one?
The InChIKey is WNSOPBKKBSOAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O/c1-13(2)9-15-7-6-12(17)16(13)11-5-3-4-10(14)8-11/h3-5,8,15H,6-7,9H2,1-2H3.
What are the key properties of 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one?
4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one has a molecular weight of 252.74 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-3,3-dimethyl-1,4-diazepan-5-one is sourced from PubChem (CID 117023493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).