C13H26N2O — CID 117023527
4-butan-2-yl-3,3,6,6-tetramethyl-1,4-diazepan-5-one (PubChem CID 117023527) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-butan-2-yl-3,3,6,6-tetramethyl-1,4-diazepan-5-one.
| Compound Name | 4-butan-2-yl-3,3,6,6-tetramethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023527 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 4-butan-2-yl-3,3,6,6-tetramethyl-1,4-diazepan-5-one |
| SMILES | CCC(C)N1C(=O)C(C)(C)CNCC1(C)C |
| InChI | InChI=1S/C13H26N2O/c1-7-10(2)15-11(16)12(3,4)8-14-9-13(15,5)6/h10,14H,7-9H2,1-6H3 |
| InChIKey | VODWOOYYDUBUAE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |