About 9H-carbazol-2-yl trifluoromethanesulfonate
9H-carbazol-2-yl trifluoromethanesulfonate (PubChem CID 11702417) has the molecular formula C13H8F3NO3S
and a molecular weight of 315.27 g/mol. Its IUPAC name is 9H-carbazol-2-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 9H-carbazol-2-yl trifluoromethanesulfonate |
| PubChem CID | 11702417 |
| Molecular Formula | C13H8F3NO3S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 9H-carbazol-2-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)[nH]c1ccccc12)C(F)(F)F |
| InChI | InChI=1S/C13H8F3NO3S/c14-13(15,16)21(18,19)20-8-5-6-10-9-3-1-2-4-11(9)17-12(10)7-8/h1-7,17H |
| InChIKey | DTBYYTIINYTKPV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazol-2-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazol-2-yl trifluoromethanesulfonate?
The IUPAC name of 9H-carbazol-2-yl trifluoromethanesulfonate (CID 11702417) is 9H-carbazol-2-yl trifluoromethanesulfonate.
What is the SMILES notation for 9H-carbazol-2-yl trifluoromethanesulfonate?
The canonical SMILES for 9H-carbazol-2-yl trifluoromethanesulfonate is O=S(=O)(Oc1ccc2c(c1)[nH]c1ccccc12)C(F)(F)F.
What is the InChIKey of 9H-carbazol-2-yl trifluoromethanesulfonate?
The InChIKey is DTBYYTIINYTKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3NO3S/c14-13(15,16)21(18,19)20-8-5-6-10-9-3-1-2-4-11(9)17-12(10)7-8/h1-7,17H.
What are the key properties of 9H-carbazol-2-yl trifluoromethanesulfonate?
9H-carbazol-2-yl trifluoromethanesulfonate has a molecular weight of 315.27 g/mol, XLogP of 3.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazol-2-yl trifluoromethanesulfonate is sourced from PubChem (CID 11702417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).