C15H22N2O2 — CID 117024402
methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)benzoate (PubChem CID 117024402) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)benzoate.
| Compound Name | methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 117024402 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)benzoate |
| SMILES | COC(=O)c1ccccc1N1CCC(N)C(C)(C)C1 |
| InChI | InChI=1S/C15H22N2O2/c1-15(2)10-17(9-8-13(15)16)12-7-5-4-6-11(12)14(18)19-3/h4-7,13H,8-10,16H2,1-3H3 |
| InChIKey | AXKGBIUHMSFETO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |