C16H22N2 — CID 117024510
3,3-dimethyl-1-(2-phenylethyl)piperidine-4-carbonitrile (PubChem CID 117024510) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-phenylethyl)piperidine-4-carbonitrile.
| Compound Name | 3,3-dimethyl-1-(2-phenylethyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 117024510 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3,3-dimethyl-1-(2-phenylethyl)piperidine-4-carbonitrile |
| SMILES | CC1(C)CN(CCc2ccccc2)CCC1C#N |
| InChI | InChI=1S/C16H22N2/c1-16(2)13-18(11-9-15(16)12-17)10-8-14-6-4-3-5-7-14/h3-7,15H,8-11,13H2,1-2H3 |
| InChIKey | FNLRSGUXDLIKIG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |