C16H23N3 — CID 117024828
2-[4-(2-aminoethyl)-3,3-dimethylpiperidin-1-yl]benzonitrile (PubChem CID 117024828) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-3,3-dimethylpiperidin-1-yl]benzonitrile.
| Compound Name | 2-[4-(2-aminoethyl)-3,3-dimethylpiperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 117024828 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2-[4-(2-aminoethyl)-3,3-dimethylpiperidin-1-yl]benzonitrile |
| SMILES | CC1(C)CN(c2ccccc2C#N)CCC1CCN |
| InChI | InChI=1S/C16H23N3/c1-16(2)12-19(10-8-14(16)7-9-17)15-6-4-3-5-13(15)11-18/h3-6,14H,7-10,12,17H2,1-2H3 |
| InChIKey | JPKVHNAXCKMFMI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |