About N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide
N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide (PubChem CID 11702547) has the molecular formula C17H17N5O2
and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide |
| PubChem CID | 11702547 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2cncc(NCc3cc(C)on3)n2)c1 |
| InChI | InChI=1S/C17H17N5O2/c1-11-6-15(22-24-11)8-19-17-10-18-9-16(21-17)13-4-3-5-14(7-13)20-12(2)23/h3-7,9-10H,8H2,1-2H3,(H,19,21)(H,20,23) |
| InChIKey | UJOLEAOYRSZYCV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide?
The IUPAC name of N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide (CID 11702547) is N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide.
What is the SMILES notation for N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide?
The canonical SMILES for N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide is CC(=O)Nc1cccc(-c2cncc(NCc3cc(C)on3)n2)c1.
What is the InChIKey of N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide?
The InChIKey is UJOLEAOYRSZYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O2/c1-11-6-15(22-24-11)8-19-17-10-18-9-16(21-17)13-4-3-5-14(7-13)20-12(2)23/h3-7,9-10H,8H2,1-2H3,(H,19,21)(H,20,23).
What are the key properties of N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide?
N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide has a molecular weight of 323.36 g/mol, XLogP of 3.01, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[6-[(5-methyl-1,2-oxazol-3-yl)methylamino]pyrazin-2-yl]phenyl]acetamide is sourced from PubChem (CID 11702547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).