C18H21N3OS — CID 11702629
4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-5H-1,3-oxazole (PubChem CID 11702629) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 11702629 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1-phenylaziridin-2-yl]-5H-1,3-oxazole |
| SMILES | Cc1csc([C@H]2N(c3ccccc3)[C@@]2(C)C2=NC(C)(C)CO2)n1 |
| InChI | InChI=1S/C18H21N3OS/c1-12-10-23-15(19-12)14-18(4,16-20-17(2,3)11-22-16)21(14)13-8-6-5-7-9-13/h5-10,14H,11H2,1-4H3/t14-,18-,21?/m1/s1 |
| InChIKey | ZAONCXQATANPOP-BOUCVHLYSA-N |
| XLogP | 3.98 |
| TPSA | 37.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|