C21H31NO2 — CID 11702664
3-cyclohexyl-3-hydroxy-3-(4-methylphenyl)-1-piperidin-1-ylpropan-1-one (PubChem CID 11702664) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 3-cyclohexyl-3-hydroxy-3-(4-methylphenyl)-1-piperidin-1-ylpropan-1-one.
| Compound Name | 3-cyclohexyl-3-hydroxy-3-(4-methylphenyl)-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 11702664 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 3-cyclohexyl-3-hydroxy-3-(4-methylphenyl)-1-piperidin-1-ylpropan-1-one |
| SMILES | Cc1ccc(C(O)(CC(=O)N2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H31NO2/c1-17-10-12-19(13-11-17)21(24,18-8-4-2-5-9-18)16-20(23)22-14-6-3-7-15-22/h10-13,18,24H,2-9,14-16H2,1H3 |
| InChIKey | GBXDGZQXNDAKBN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |