C22H34O2 — CID 11702683
(3S,10S,13S,17S)-10-[(Z)-but-1-enyl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11702683) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (3S,10S,13S,17S)-10-[(Z)-but-1-enyl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3S,10S,13S,17S)-10-[(Z)-but-1-enyl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11702683 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (3S,10S,13S,17S)-10-[(Z)-but-1-enyl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC/C=C\[C@]12CC[C@H](O)CC1=CCC1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C22H34O2/c1-3-4-11-22-13-9-16(23)14-15(22)5-6-17-18-7-8-20(24)21(18,2)12-10-19(17)22/h4-5,11,16-20,23-24H,3,6-10,12-14H2,1-2H3/b11-4-/t16-,17?,18?,19?,20-,21-,22-/m0/s1 |
| InChIKey | XWXPYFOXMZUJSC-CFFQFHGKSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|