C13H18BrNO — CID 117027951
[1-(3-bromo-4-methylphenyl)piperidin-4-yl]methanol (PubChem CID 117027951) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is [1-(3-bromo-4-methylphenyl)piperidin-4-yl]methanol.
| Compound Name | [1-(3-bromo-4-methylphenyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 117027951 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [1-(3-bromo-4-methylphenyl)piperidin-4-yl]methanol |
| SMILES | Cc1ccc(N2CCC(CO)CC2)cc1Br |
| InChI | InChI=1S/C13H18BrNO/c1-10-2-3-12(8-13(10)14)15-6-4-11(9-16)5-7-15/h2-3,8,11,16H,4-7,9H2,1H3 |
| InChIKey | OSPSZQJQMCBPGO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |