C13H17N3 — CID 117028174
2-[1-(pyridin-3-ylmethyl)piperidin-2-yl]acetonitrile (PubChem CID 117028174) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-[1-(pyridin-3-ylmethyl)piperidin-2-yl]acetonitrile.
| Compound Name | 2-[1-(pyridin-3-ylmethyl)piperidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 117028174 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-[1-(pyridin-3-ylmethyl)piperidin-2-yl]acetonitrile |
| SMILES | N#CCC1CCCCN1Cc1cccnc1 |
| InChI | InChI=1S/C13H17N3/c14-7-6-13-5-1-2-9-16(13)11-12-4-3-8-15-10-12/h3-4,8,10,13H,1-2,5-6,9,11H2 |
| InChIKey | LKIQKQQTYBKFIE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |