About 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea
1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea (PubChem CID 11702880) has the molecular formula C18H23N5O2
and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea |
| PubChem CID | 11702880 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea |
| SMILES | N#C[C@@H]1CCCN1C(=O)[C@@H]1CC[C@H](CNC(=O)Nc2ccccc2)N1 |
| InChI | InChI=1S/C18H23N5O2/c19-11-15-7-4-10-23(15)17(24)16-9-8-14(21-16)12-20-18(25)22-13-5-2-1-3-6-13/h1-3,5-6,14-16,21H,4,7-10,12H2,(H2,20,22,25)/t14-,15+,16+/m1/s1 |
| InChIKey | PORKEEGCMBVWKU-PMPSAXMXSA-N |
| XLogP | 1.44 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea?
The IUPAC name of 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea (CID 11702880) is 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea.
What is the SMILES notation for 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea?
The canonical SMILES for 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea is N#C[C@@H]1CCCN1C(=O)[C@@H]1CC[C@H](CNC(=O)Nc2ccccc2)N1.
What is the InChIKey of 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea?
The InChIKey is PORKEEGCMBVWKU-PMPSAXMXSA-N. The full InChI is InChI=1S/C18H23N5O2/c19-11-15-7-4-10-23(15)17(24)16-9-8-14(21-16)12-20-18(25)22-13-5-2-1-3-6-13/h1-3,5-6,14-16,21H,4,7-10,12H2,(H2,20,22,25)/t14-,15+,16+/m1/s1.
What are the key properties of 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea?
1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea has a molecular weight of 341.41 g/mol, XLogP of 1.44, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2R,5S)-5-[(2S)-2-cyanopyrrolidine-1-carbonyl]pyrrolidin-2-yl]methyl]-3-phenylurea is sourced from PubChem (CID 11702880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).