C12H21N3O2 — CID 117029785
1-[2-(4-methylpiperazin-2-yl)ethyl]piperidine-2,6-dione (PubChem CID 117029785) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-[2-(4-methylpiperazin-2-yl)ethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-(4-methylpiperazin-2-yl)ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 117029785 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1-[2-(4-methylpiperazin-2-yl)ethyl]piperidine-2,6-dione |
| SMILES | CN1CCNC(CCN2C(=O)CCCC2=O)C1 |
| InChI | InChI=1S/C12H21N3O2/c1-14-8-6-13-10(9-14)5-7-15-11(16)3-2-4-12(15)17/h10,13H,2-9H2,1H3 |
| InChIKey | PWGMPARBUJIKSH-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|