C7H11NO5S — CID 117029890
3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)butanoic acid (PubChem CID 117029890) has the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. Its IUPAC name is 3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)butanoic acid.
| Compound Name | 3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 117029890 |
| Molecular Formula | C7H11NO5S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-(1,1,3-trioxo-1,2-thiazolidin-2-yl)butanoic acid |
| SMILES | CC(CC(=O)O)N1C(=O)CCS1(=O)=O |
| InChI | InChI=1S/C7H11NO5S/c1-5(4-7(10)11)8-6(9)2-3-14(8,12)13/h5H,2-4H2,1H3,(H,10,11) |
| InChIKey | HXYIUCNVYLPURB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |