C21H36O2Si — CID 11703011
1-[(1R,2S,3S,4S)-3-[2-tri(propan-2-yl)silyloxyethyl]-2-bicyclo[2.2.1]hept-5-enyl]prop-2-en-1-one (PubChem CID 11703011) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is 1-[(1R,2S,3S,4S)-3-[2-tri(propan-2-yl)silyloxyethyl]-2-bicyclo[2.2.1]hept-5-enyl]prop-2-en-1-one.
| Compound Name | 1-[(1R,2S,3S,4S)-3-[2-tri(propan-2-yl)silyloxyethyl]-2-bicyclo[2.2.1]hept-5-enyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11703011 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 1-[(1R,2S,3S,4S)-3-[2-tri(propan-2-yl)silyloxyethyl]-2-bicyclo[2.2.1]hept-5-enyl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@@H]1[C@@H](CCO[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C21H36O2Si/c1-8-20(22)21-18-10-9-17(13-18)19(21)11-12-23-24(14(2)3,15(4)5)16(6)7/h8-10,14-19,21H,1,11-13H2,2-7H3/t17-,18+,19+,21+/m1/s1 |
| InChIKey | KTTRSJSNXMXYFK-JKBKZWBZSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|