C17H18N2O — CID 117030198
4-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)cyclohexan-1-one (PubChem CID 117030198) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)cyclohexan-1-one.
| Compound Name | 4-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 117030198 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-(2,3-dihydropyrrolo[2,3-b]quinolin-1-yl)cyclohexan-1-one |
| SMILES | O=C1CCC(N2CCc3cc4ccccc4nc32)CC1 |
| InChI | InChI=1S/C17H18N2O/c20-15-7-5-14(6-8-15)19-10-9-13-11-12-3-1-2-4-16(12)18-17(13)19/h1-4,11,14H,5-10H2 |
| InChIKey | UOAJFYPZYHCUMM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |