C11H13BrN2O2 — CID 117030398
7-bromo-1-(2-hydroxyethyl)-4-methyl-3H-quinoxalin-2-one (PubChem CID 117030398) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 7-bromo-1-(2-hydroxyethyl)-4-methyl-3H-quinoxalin-2-one.
| Compound Name | 7-bromo-1-(2-hydroxyethyl)-4-methyl-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 117030398 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 7-bromo-1-(2-hydroxyethyl)-4-methyl-3H-quinoxalin-2-one |
| SMILES | CN1CC(=O)N(CCO)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H13BrN2O2/c1-13-7-11(16)14(4-5-15)10-6-8(12)2-3-9(10)13/h2-3,6,15H,4-5,7H2,1H3 |
| InChIKey | JLAASLVPCDLYQF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |