About 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline
7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline (PubChem CID 117031142) has the molecular formula C15H23BrN4
and a molecular weight of 339.28 g/mol. Its IUPAC name is 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 117031142 |
| Molecular Formula | C15H23BrN4 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline |
| SMILES | CN1CCNCC1CCN1CCNc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H23BrN4/c1-19-8-5-17-11-13(19)4-7-20-9-6-18-14-10-12(16)2-3-15(14)20/h2-3,10,13,17-18H,4-9,11H2,1H3 |
| InChIKey | URXRRAFLWMCFBC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline (CID 117031142) is 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline is CN1CCNCC1CCN1CCNc2cc(Br)ccc21.
What is the InChIKey of 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline?
The InChIKey is URXRRAFLWMCFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23BrN4/c1-19-8-5-17-11-13(19)4-7-20-9-6-18-14-10-12(16)2-3-15(14)20/h2-3,10,13,17-18H,4-9,11H2,1H3.
What are the key properties of 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline?
7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline has a molecular weight of 339.28 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-[2-(1-methylpiperazin-2-yl)ethyl]-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 117031142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).