About 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid
3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid (PubChem CID 117031298) has the molecular formula C13H13N3O3
and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid |
| PubChem CID | 117031298 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid |
| SMILES | CC(CC(=O)O)N1C(=O)CNc2ccc(C#N)cc21 |
| InChI | InChI=1S/C13H13N3O3/c1-8(4-13(18)19)16-11-5-9(6-14)2-3-10(11)15-7-12(16)17/h2-3,5,8,15H,4,7H2,1H3,(H,18,19) |
| InChIKey | QMXIXOYYLIOMNO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid?
The IUPAC name of 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid (CID 117031298) is 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid.
What is the SMILES notation for 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid?
The canonical SMILES for 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid is CC(CC(=O)O)N1C(=O)CNc2ccc(C#N)cc21.
What is the InChIKey of 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid?
The InChIKey is QMXIXOYYLIOMNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3/c1-8(4-13(18)19)16-11-5-9(6-14)2-3-10(11)15-7-12(16)17/h2-3,5,8,15H,4,7H2,1H3,(H,18,19).
What are the key properties of 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid?
3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid has a molecular weight of 259.26 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-cyano-2-oxo-3,4-dihydroquinoxalin-1-yl)butanoic acid is sourced from PubChem (CID 117031298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).