About 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane
3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane (PubChem CID 117032014) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane.
Molecular Properties
| Compound Name | 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane |
| PubChem CID | 117032014 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane |
| SMILES | COc1cc(C)c(C)cc1SCC1COC1 |
| InChI | InChI=1S/C13H18O2S/c1-9-4-12(14-3)13(5-10(9)2)16-8-11-6-15-7-11/h4-5,11H,6-8H2,1-3H3 |
| InChIKey | GCJOWAKUINROAM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane?
The IUPAC name of 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane (CID 117032014) is 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane.
What is the SMILES notation for 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane?
The canonical SMILES for 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane is COc1cc(C)c(C)cc1SCC1COC1.
What is the InChIKey of 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane?
The InChIKey is GCJOWAKUINROAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S/c1-9-4-12(14-3)13(5-10(9)2)16-8-11-6-15-7-11/h4-5,11H,6-8H2,1-3H3.
What are the key properties of 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane?
3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane has a molecular weight of 238.35 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methoxy-4,5-dimethylphenyl)sulfanylmethyl]oxetane is sourced from PubChem (CID 117032014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).