C16H27N7O3 — CID 11703335
N-[[(5R)-15-(dimethylamino)-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]-N-hydroxyformamide (PubChem CID 11703335) has the molecular formula C16H27N7O3 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[[(5R)-15-(dimethylamino)-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]-N-hydroxyformamide.
| Compound Name | N-[[(5R)-15-(dimethylamino)-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11703335 |
| Molecular Formula | C16H27N7O3 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[[(5R)-15-(dimethylamino)-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]-N-hydroxyformamide |
| SMILES | CN(C)c1nc2nc(n1)NNC(=O)[C@@H](CN(O)C=O)CCCCCCC2 |
| InChI | InChI=1S/C16H27N7O3/c1-22(2)16-18-13-9-7-5-3-4-6-8-12(10-23(26)11-24)14(25)20-21-15(17-13)19-16/h11-12,26H,3-10H2,1-2H3,(H,20,25)(H,17,18,19,21)/t12-/m1/s1 |
| InChIKey | JNRHYMCDWLHAGE-GFCCVEGCSA-N |
| XLogP | 0.74 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|