C18H36O6Si — CID 11703539
(2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(Z)-hex-3-enoxy]oxane-3,4,5-triol (PubChem CID 11703539) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(Z)-hex-3-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(Z)-hex-3-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11703539 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(Z)-hex-3-enoxy]oxane-3,4,5-triol |
| SMILES | CC/C=C\CCO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H36O6Si/c1-7-8-9-10-11-22-17-16(21)15(20)14(19)13(24-17)12-23-25(5,6)18(2,3)4/h8-9,13-17,19-21H,7,10-12H2,1-6H3/b9-8-/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | JJQHPJKKCSYHSK-VZYUEOSHSA-N |
| XLogP | 2.19 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|