C19H24F3N3O2 — CID 11703667
1-[4-[1-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl]piperazin-1-yl]ethanone (PubChem CID 11703667) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-[4-[1-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[1-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 11703667 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[4-[1-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)C2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C19H24F3N3O2/c1-14(26)23-9-11-25(12-10-23)18(27)15-5-7-24(8-6-15)17-4-2-3-16(13-17)19(20,21)22/h2-4,13,15H,5-12H2,1H3 |
| InChIKey | MHYUMMXNPZWJHY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |