C10H13NO5S — CID 117037884
2-(4-methoxyphenyl)sulfonyl-2-(methylamino)acetic acid (PubChem CID 117037884) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-2-(methylamino)acetic acid.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 117037884 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C10H13NO5S/c1-11-9(10(12)13)17(14,15)8-5-3-7(16-2)4-6-8/h3-6,9,11H,1-2H3,(H,12,13) |
| InChIKey | RJTKCMZLPNRPAU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |